C6H13NO3 — CID 135301042
(2R,3S)-5-methyliminopentane-1,2,3-triol (PubChem CID 135301042) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is (2R,3S)-5-methyliminopentane-1,2,3-triol.
| Compound Name | (2R,3S)-5-methyliminopentane-1,2,3-triol |
|---|---|
| PubChem CID | 135301042 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (2R,3S)-5-methyliminopentane-1,2,3-triol |
| SMILES | C/N=C/C[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO3/c1-7-3-2-5(9)6(10)4-8/h3,5-6,8-10H,2,4H2,1H3/b7-3+/t5-,6+/m0/s1 |
| InChIKey | DXMFXYAKPOQOCT-GXVUIQDXSA-N |
| XLogP | -1.21 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|