C8H16F3N3O2 — CID 135301717
(2S)-4,4,4-trifluoro-2-(methoxymethylamino)-3,3-dimethylbutanehydrazide (PubChem CID 135301717) has the molecular formula C8H16F3N3O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is (2S)-4,4,4-trifluoro-2-(methoxymethylamino)-3,3-dimethylbutanehydrazide.
| Compound Name | (2S)-4,4,4-trifluoro-2-(methoxymethylamino)-3,3-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 135301717 |
| Molecular Formula | C8H16F3N3O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | (2S)-4,4,4-trifluoro-2-(methoxymethylamino)-3,3-dimethylbutanehydrazide |
| SMILES | COCN[C@H](C(=O)NN)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O2/c1-7(2,8(9,10)11)5(6(15)14-12)13-4-16-3/h5,13H,4,12H2,1-3H3,(H,14,15)/t5-/m1/s1 |
| InChIKey | WRPIIERZOUBCKT-RXMQYKEDSA-N |
| XLogP | 0.13 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|