C21H20ClN3O4S — CID 135369976
5-(4-chlorophenyl)-2-(2-hydroxyethylamino)-3-(4-sulfamoylphenyl)benzamide (PubChem CID 135369976) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(2-hydroxyethylamino)-3-(4-sulfamoylphenyl)benzamide.
| Compound Name | 5-(4-chlorophenyl)-2-(2-hydroxyethylamino)-3-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 135369976 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(2-hydroxyethylamino)-3-(4-sulfamoylphenyl)benzamide |
| SMILES | NC(=O)c1cc(-c2ccc(Cl)cc2)cc(-c2ccc(S(N)(=O)=O)cc2)c1NCCO |
| InChI | InChI=1S/C21H20ClN3O4S/c22-16-5-1-13(2-6-16)15-11-18(14-3-7-17(8-4-14)30(24,28)29)20(25-9-10-26)19(12-15)21(23)27/h1-8,11-12,25-26H,9-10H2,(H2,23,27)(H2,24,28,29) |
| InChIKey | YNQZLLCNTSWNDL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |