C16H13N3O6S — CID 135408330
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3-nitrobenzoate (PubChem CID 135408330) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3-nitrobenzoate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3-nitrobenzoate |
|---|---|
| PubChem CID | 135408330 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3-nitrobenzoate |
| SMILES | O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N3O6S/c20-16(11-4-3-5-12(10-11)19(21)22)25-9-8-17-15-13-6-1-2-7-14(13)26(23,24)18-15/h1-7,10H,8-9H2,(H,17,18) |
| InChIKey | RUEYQTBHJGLGQI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|