C16H13FN2O4S — CID 135462801
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-fluorobenzoate (PubChem CID 135462801) has the molecular formula C16H13FN2O4S and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-fluorobenzoate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 135462801 |
| Molecular Formula | C16H13FN2O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-fluorobenzoate |
| SMILES | O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1F |
| InChI | InChI=1S/C16H13FN2O4S/c17-13-7-3-1-5-11(13)16(20)23-10-9-18-15-12-6-2-4-8-14(12)24(21,22)19-15/h1-8H,9-10H2,(H,18,19) |
| InChIKey | FCPSZORSWMGREB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|