C18H17BrN2O5S — CID 135412855
2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 2-bromobenzoate (PubChem CID 135412855) has the molecular formula C18H17BrN2O5S and a molecular weight of 453.31 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 2-bromobenzoate.
| Compound Name | 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 2-bromobenzoate |
|---|---|
| PubChem CID | 135412855 |
| Molecular Formula | C18H17BrN2O5S |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 2-bromobenzoate |
| SMILES | O=C(OCCOCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1Br |
| InChI | InChI=1S/C18H17BrN2O5S/c19-15-7-3-1-5-13(15)18(22)26-12-11-25-10-9-20-17-14-6-2-4-8-16(14)27(23,24)21-17/h1-8H,9-12H2,(H,20,21) |
| InChIKey | QPRVUWGLNRRLMB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|