C32H22N4O4 — CID 135429950
N-[(Z)-2-(4-acetamidophenyl)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)ethenyl]benzamide (PubChem CID 135429950) has the molecular formula C32H22N4O4 and a molecular weight of 526.55 g/mol. Its IUPAC name is N-[(Z)-2-(4-acetamidophenyl)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)ethenyl]benzamide.
| Compound Name | N-[(Z)-2-(4-acetamidophenyl)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)ethenyl]benzamide |
|---|---|
| PubChem CID | 135429950 |
| Molecular Formula | C32H22N4O4 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N-[(Z)-2-(4-acetamidophenyl)-1-(6,11-dioxo-1H-naphtho[2,3-e]benzimidazol-2-yl)ethenyl]benzamide |
| SMILES | CC(=O)Nc1ccc(/C=C(\NC(=O)c2ccccc2)c2nc3ccc4c(c3[nH]2)C(=O)c2ccccc2C4=O)cc1 |
| InChI | InChI=1S/C32H22N4O4/c1-18(37)33-21-13-11-19(12-14-21)17-26(35-32(40)20-7-3-2-4-8-20)31-34-25-16-15-24-27(28(25)36-31)30(39)23-10-6-5-9-22(23)29(24)38/h2-17H,1H3,(H,33,37)(H,34,36)(H,35,40)/b26-17- |
| InChIKey | OQDKQQIJHWYULB-ONUIUJJFSA-N |
| XLogP | 5.22 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|