C27H19Br4N5O6 — CID 135446100
N,N'-bis[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanediamide (PubChem CID 135446100) has the molecular formula C27H19Br4N5O6 and a molecular weight of 829.09 g/mol. Its IUPAC name is N,N'-bis[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanediamide.
| Compound Name | N,N'-bis[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanediamide |
|---|---|
| PubChem CID | 135446100 |
| Molecular Formula | C27H19Br4N5O6 |
| Molecular Weight | 829.09 g/mol |
| Exact Mass | 824.81 |
| IUPAC Name | N,N'-bis[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanediamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(O)c(Br)c1O)C(Nc1cccc2ccccc12)C(=O)N/N=C/c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C27H19Br4N5O6/c28-16-8-13(22(37)19(30)24(16)39)10-32-35-26(41)21(34-18-7-3-5-12-4-1-2-6-15(12)18)27(42)36-33-11-14-9-17(29)25(40)20(31)23(14)38/h1-11,21,34,37-40H,(H,35,41)(H,36,42)/b32-10+,33-11+ |
| InChIKey | VPEUDQMIRBGCHL-INVBIMAJSA-N |
| XLogP | 5.79 |
| TPSA | 175.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.09 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|