C19H20N4O7S2 — CID 135448274
4-hydroxy-6-(methylamino)-5-[[5-(methylaminomethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135448274) has the molecular formula C19H20N4O7S2 and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-hydroxy-6-(methylamino)-5-[[5-(methylaminomethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-6-(methylamino)-5-[[5-(methylaminomethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135448274 |
| Molecular Formula | C19H20N4O7S2 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 4-hydroxy-6-(methylamino)-5-[[5-(methylaminomethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CNCc1ccc(S(=O)(=O)O)c(/N=N/c2c(NC)ccc3cc(S(=O)(=O)O)cc(O)c23)c1 |
| InChI | InChI=1S/C19H20N4O7S2/c1-20-10-11-3-6-17(32(28,29)30)15(7-11)22-23-19-14(21-2)5-4-12-8-13(31(25,26)27)9-16(24)18(12)19/h3-9,20-21,24H,10H2,1-2H3,(H,25,26,27)(H,28,29,30)/b23-22+ |
| InChIKey | CGQBAWFWKNMYRS-GHVJWSGMSA-N |
| XLogP | 3.22 |
| TPSA | 177.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|