C22H18CuN4O11S3 — CID 135972020
copper;4-hydroxy-5-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-6-(2-hydroxy-5-sulfoanilino)naphthalene-2-sulfonic acid (PubChem CID 135972020) has the molecular formula C22H18CuN4O11S3 and a molecular weight of 674.15 g/mol. Its IUPAC name is copper;4-hydroxy-5-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-6-(2-hydroxy-5-sulfoanilino)naphthalene-2-sulfonic acid.
| Compound Name | copper;4-hydroxy-5-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-6-(2-hydroxy-5-sulfoanilino)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135972020 |
| Molecular Formula | C22H18CuN4O11S3 |
| Molecular Weight | 674.15 g/mol |
| Exact Mass | 672.94 |
| IUPAC Name | copper;4-hydroxy-5-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-6-(2-hydroxy-5-sulfoanilino)naphthalene-2-sulfonic acid |
| SMILES | NS(=O)(=O)c1ccc(O)c(/N=N/c2c(Nc3cc(S(=O)(=O)O)ccc3O)ccc3cc(S(=O)(=O)O)cc(O)c23)c1.[Cu] |
| InChI | InChI=1S/C22H18N4O11S3.Cu/c23-38(30,31)12-2-5-19(28)17(8-12)25-26-22-15(24-16-9-13(39(32,33)34)3-6-18(16)27)4-1-11-7-14(40(35,36)37)10-20(29)21(11)22;/h1-10,24,27-29H,(H2,23,30,31)(H,32,33,34)(H,35,36,37);/b26-25+; |
| InChIKey | PMXRUUJQPQFLEC-BTKVJIOYSA-N |
| XLogP | 3.25 |
| TPSA | 266.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.15 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|