C8H11N5O3 — CID 135455615
6-amino-1-(2-hydroxyethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135455615) has the molecular formula C8H11N5O3 and a molecular weight of 225.21 g/mol. Its IUPAC name is 6-amino-1-(2-hydroxyethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-amino-1-(2-hydroxyethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135455615 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 6-amino-1-(2-hydroxyethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(cnn2COCCO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)3-10-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
| InChIKey | XGKAEIFKPVRTCA-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|