C34H22N6S2 — CID 135478839
1-N,4-N-bis(thioxanthen-9-ylideneamino)-2,3-dihydrophthalazine-1,4-diimine (PubChem CID 135478839) has the molecular formula C34H22N6S2 and a molecular weight of 578.73 g/mol. Its IUPAC name is 1-N,4-N-bis(thioxanthen-9-ylideneamino)-2,3-dihydrophthalazine-1,4-diimine.
| Compound Name | 1-N,4-N-bis(thioxanthen-9-ylideneamino)-2,3-dihydrophthalazine-1,4-diimine |
|---|---|
| PubChem CID | 135478839 |
| Molecular Formula | C34H22N6S2 |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | 1-N,4-N-bis(thioxanthen-9-ylideneamino)-2,3-dihydrophthalazine-1,4-diimine |
| SMILES | c1ccc2c(=N/N=c3/[nH][nH]/c(=N/N=c4c5ccccc5sc5ccccc45)c4ccccc34)c3ccccc3sc2c1 |
| InChI | InChI=1S/C34H22N6S2/c1-2-12-22-21(11-1)33(37-35-31-23-13-3-7-17-27(23)41-28-18-8-4-14-24(28)31)39-40-34(22)38-36-32-25-15-5-9-19-29(25)42-30-20-10-6-16-26(30)32/h1-20H,(H,37,39)(H,38,40) |
| InChIKey | GAAONXPZKCOHPI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|