C17H10N6O2 — CID 135492484
4-[(E)-(2-oxo-1H-indol-3-ylidene)amino]-5H-[1,2,4]triazino[5,6-b]indol-3-one (PubChem CID 135492484) has the molecular formula C17H10N6O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 4-[(E)-(2-oxo-1H-indol-3-ylidene)amino]-5H-[1,2,4]triazino[5,6-b]indol-3-one.
| Compound Name | 4-[(E)-(2-oxo-1H-indol-3-ylidene)amino]-5H-[1,2,4]triazino[5,6-b]indol-3-one |
|---|---|
| PubChem CID | 135492484 |
| Molecular Formula | C17H10N6O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-[(E)-(2-oxo-1H-indol-3-ylidene)amino]-5H-[1,2,4]triazino[5,6-b]indol-3-one |
| SMILES | O=C1Nc2ccccc2/C1=N\n1c(=O)nnc2c3ccccc3[nH]c21 |
| InChI | InChI=1S/C17H10N6O2/c24-16-14(10-6-2-4-8-12(10)19-16)22-23-15-13(20-21-17(23)25)9-5-1-3-7-11(9)18-15/h1-8,18H,(H,19,22,24) |
| InChIKey | JFLBMHBLSUPQQJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|