C11H7N5 — CID 137250074
2,5,7,8,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene (PubChem CID 137250074) has the molecular formula C11H7N5 and a molecular weight of 209.21 g/mol. Its IUPAC name is 2,5,7,8,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene.
| Compound Name | 2,5,7,8,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 137250074 |
| Molecular Formula | C11H7N5 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2,5,7,8,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
| SMILES | c1ccc2c(c1)[nH]c1c2nnc2nccn21 |
| InChI | InChI=1S/C11H7N5/c1-2-4-8-7(3-1)9-10(13-8)16-6-5-12-11(16)15-14-9/h1-6,13H |
| InChIKey | HYXRAOGNFVBBIW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |