C15H16N8O4S — CID 135502097
5-methyl-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboximidamide (PubChem CID 135502097) has the molecular formula C15H16N8O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is 5-methyl-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboximidamide.
| Compound Name | 5-methyl-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 135502097 |
| Molecular Formula | C15H16N8O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 5-methyl-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboximidamide |
| SMILES | [H]/N=C(\N)n1[nH]c(C)c(/N=N/c2ccc(S(=O)(=O)Nc3cc(C)on3)cc2)c1=O |
| InChI | InChI=1S/C15H16N8O4S/c1-8-7-12(21-27-8)22-28(25,26)11-5-3-10(4-6-11)18-19-13-9(2)20-23(14(13)24)15(16)17/h3-7,20H,1-2H3,(H3,16,17)(H,21,22)/b19-18+ |
| InChIKey | ZNAOJFRTEFTDEP-VHEBQXMUSA-N |
| XLogP | 1.74 |
| TPSA | 184.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|