C22H19ClN6O4S — CID 137117464
4-[[2-[1-(4-chlorophenyl)ethenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 137117464) has the molecular formula C22H19ClN6O4S and a molecular weight of 498.95 g/mol. Its IUPAC name is 4-[[2-[1-(4-chlorophenyl)ethenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-[[2-[1-(4-chlorophenyl)ethenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 137117464 |
| Molecular Formula | C22H19ClN6O4S |
| Molecular Weight | 498.95 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 4-[[2-[1-(4-chlorophenyl)ethenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | C=C(c1ccc(Cl)cc1)n1[nH]c(C)c(/N=N/c2ccc(S(=O)(=O)Nc3cc(C)on3)cc2)c1=O |
| InChI | InChI=1S/C22H19ClN6O4S/c1-13-12-20(27-33-13)28-34(31,32)19-10-8-18(9-11-19)24-25-21-14(2)26-29(22(21)30)15(3)16-4-6-17(23)7-5-16/h4-12,26H,3H2,1-2H3,(H,27,28)/b25-24+ |
| InChIKey | MVVSWBMAFXYRGG-OCOZRVBESA-N |
| XLogP | 5.17 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|