About 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide
5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide (PubChem CID 135415653) has the molecular formula C14H13N7O5S
and a molecular weight of 391.37 g/mol. Its IUPAC name is 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide |
| PubChem CID | 135415653 |
| Molecular Formula | C14H13N7O5S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide |
| SMILES | Cc1[nH]n(C(N)=O)c(=O)c1/N=N/c1ccc(S(=O)(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C14H13N7O5S/c1-8-12(13(22)21(18-8)14(15)23)17-16-9-2-4-10(5-3-9)27(24,25)20-11-6-7-26-19-11/h2-7,18H,1H3,(H2,15,23)(H,19,20)/b17-16+ |
| InChIKey | JQOPPHKITXEXEQ-WUKNDPDISA-N |
| XLogP | 1.62 |
| TPSA | 177.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide?
The IUPAC name of 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide (CID 135415653) is 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide.
What is the SMILES notation for 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide?
The canonical SMILES for 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide is Cc1[nH]n(C(N)=O)c(=O)c1/N=N/c1ccc(S(=O)(=O)Nc2ccon2)cc1.
What is the InChIKey of 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide?
The InChIKey is JQOPPHKITXEXEQ-WUKNDPDISA-N. The full InChI is InChI=1S/C14H13N7O5S/c1-8-12(13(22)21(18-8)14(15)23)17-16-9-2-4-10(5-3-9)27(24,25)20-11-6-7-26-19-11/h2-7,18H,1H3,(H2,15,23)(H,19,20)/b17-16+.
What are the key properties of 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide?
5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide has a molecular weight of 391.37 g/mol, XLogP of 1.62, 5 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-[[4-(1,2-oxazol-3-ylsulfamoyl)phenyl]diazenyl]-3-oxo-1H-pyrazole-2-carboxamide is sourced from PubChem (CID 135415653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).