C21H22N9O6S+ — CID 135402672
[amino-[5-methyl-3-oxo-4-[[4-[(1-phenylpyrrol-3-yl)sulfamoyl]phenyl]diazenyl]-1H-pyrazol-2-yl]methylidene]azanium;nitric acid (PubChem CID 135402672) has the molecular formula C21H22N9O6S+ and a molecular weight of 528.53 g/mol. Its IUPAC name is [amino-[5-methyl-3-oxo-4-[[4-[(1-phenylpyrrol-3-yl)sulfamoyl]phenyl]diazenyl]-1H-pyrazol-2-yl]methylidene]azanium;nitric acid.
| Compound Name | [amino-[5-methyl-3-oxo-4-[[4-[(1-phenylpyrrol-3-yl)sulfamoyl]phenyl]diazenyl]-1H-pyrazol-2-yl]methylidene]azanium;nitric acid |
|---|---|
| PubChem CID | 135402672 |
| Molecular Formula | C21H22N9O6S+ |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [amino-[5-methyl-3-oxo-4-[[4-[(1-phenylpyrrol-3-yl)sulfamoyl]phenyl]diazenyl]-1H-pyrazol-2-yl]methylidene]azanium;nitric acid |
| SMILES | Cc1[nH]n(C(N)=[NH2+])c(=O)c1/N=N/c1ccc(S(=O)(=O)Nc2ccn(-c3ccccc3)c2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C21H20N8O3S.HNO3/c1-14-19(20(30)29(26-14)21(22)23)25-24-15-7-9-18(10-8-15)33(31,32)27-16-11-12-28(13-16)17-5-3-2-4-6-17;2-1(3)4/h2-13,26-27H,1H3,(H3,22,23);(H,2,3,4)/p+1/b25-24+; |
| InChIKey | YJFIDCCJIAPHLM-QREUMGABSA-O |
| XLogP | 1.07 |
| TPSA | 228.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|