C28H22N6NaO10S2+ — CID 135510110
sodium 2-[2-[4-[(E)-2-[4-[2-(2-carboxyphenyl)iminohydrazinyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminohydrazinyl]benzoic acid (PubChem CID 135510110) has the molecular formula C28H22N6NaO10S2+ and a molecular weight of 689.64 g/mol. Its IUPAC name is sodium 2-[2-[4-[(E)-2-[4-[2-(2-carboxyphenyl)iminohydrazinyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminohydrazinyl]benzoic acid.
| Compound Name | sodium 2-[2-[4-[(E)-2-[4-[2-(2-carboxyphenyl)iminohydrazinyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminohydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 135510110 |
| Molecular Formula | C28H22N6NaO10S2+ |
| Molecular Weight | 689.64 g/mol |
| Exact Mass | 689.07 |
| IUPAC Name | sodium 2-[2-[4-[(E)-2-[4-[2-(2-carboxyphenyl)iminohydrazinyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminohydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/N=N/Nc1ccc(/C=C/c2ccc(/N=N/Nc3ccccc3C(=O)O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C28H22N6O10S2.Na/c35-27(36)21-5-1-3-7-23(21)31-33-29-19-13-11-17(25(15-19)45(39,40)41)9-10-18-12-14-20(16-26(18)46(42,43)44)30-34-32-24-8-4-2-6-22(24)28(37)38;/h1-16H,(H,29,31)(H,30,32)(H,35,36)(H,37,38)(H,39,40,41)(H,42,43,44);/q;+1/b10-9+; |
| InChIKey | LMHALHCGXPDZDO-RRABGKBLSA-N |
| XLogP | 2.97 |
| TPSA | 256.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|