C25H27N7O7 — CID 135514653
diethyl 2-[[4-[(2-acetamido-4-oxo-3H-pteridin-6-yl)methylideneamino]-2,3,5,6-tetradeuteriobenzoyl]amino]pentanedioate (PubChem CID 135514653) has the molecular formula C25H27N7O7 and a molecular weight of 541.56 g/mol. Its IUPAC name is diethyl 2-[[4-[(2-acetamido-4-oxo-3H-pteridin-6-yl)methylideneamino]-2,3,5,6-tetradeuteriobenzoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[4-[(2-acetamido-4-oxo-3H-pteridin-6-yl)methylideneamino]-2,3,5,6-tetradeuteriobenzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 135514653 |
| Molecular Formula | C25H27N7O7 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | diethyl 2-[[4-[(2-acetamido-4-oxo-3H-pteridin-6-yl)methylideneamino]-2,3,5,6-tetradeuteriobenzoyl]amino]pentanedioate |
| SMILES | [2H]c1c([2H])c(C(=O)NC(CCC(=O)OCC)C(=O)OCC)c([2H])c([2H])c1/N=C/c1cnc2nc(NC(C)=O)[nH]c(=O)c2n1 |
| InChI | InChI=1S/C25H27N7O7/c1-4-38-19(34)11-10-18(24(37)39-5-2)30-22(35)15-6-8-16(9-7-15)26-12-17-13-27-21-20(29-17)23(36)32-25(31-21)28-14(3)33/h6-9,12-13,18H,4-5,10-11H2,1-3H3,(H,30,35)(H2,27,28,31,32,33,36)/b26-12+/i6D,7D,8D,9D |
| InChIKey | SSXDKYXRWSPBTC-CMRIGZEYSA-N |
| XLogP | 1.43 |
| TPSA | 194.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|