C11H6N2O4S2 — CID 135553570
7-(6-hydroxy-1,3-benzothiazol-2-yl)-1,2-dioxa-6-thia-8-azaspiro[3.4]oct-7-en-3-one (PubChem CID 135553570) has the molecular formula C11H6N2O4S2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 7-(6-hydroxy-1,3-benzothiazol-2-yl)-1,2-dioxa-6-thia-8-azaspiro[3.4]oct-7-en-3-one.
| Compound Name | 7-(6-hydroxy-1,3-benzothiazol-2-yl)-1,2-dioxa-6-thia-8-azaspiro[3.4]oct-7-en-3-one |
|---|---|
| PubChem CID | 135553570 |
| Molecular Formula | C11H6N2O4S2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 7-(6-hydroxy-1,3-benzothiazol-2-yl)-1,2-dioxa-6-thia-8-azaspiro[3.4]oct-7-en-3-one |
| SMILES | O=C1OOC12CSC(c1nc3ccc(O)cc3s1)=N2 |
| InChI | InChI=1S/C11H6N2O4S2/c14-5-1-2-6-7(3-5)19-8(12-6)9-13-11(4-18-9)10(15)16-17-11/h1-3,14H,4H2 |
| InChIKey | SGSVGKXZUSJOKI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|