C22H16N3O2- — CID 135556740
3-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]benzoate (PubChem CID 135556740) has the molecular formula C22H16N3O2- and a molecular weight of 354.39 g/mol. Its IUPAC name is 3-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 135556740 |
| Molecular Formula | C22H16N3O2- |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]benzoate |
| SMILES | O=C([O-])c1cccc(N/N=C/c2c(-c3ccccc3)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H17N3O2/c26-22(27)16-9-6-10-17(13-16)25-23-14-19-18-11-4-5-12-20(18)24-21(19)15-7-2-1-3-8-15/h1-14,24-25H,(H,26,27)/p-1/b23-14+ |
| InChIKey | KJFMCYYRWINPKY-OEAKJJBVSA-M |
| XLogP | 3.64 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|