C14H10N6O5 — CID 135562924
N-[(E)-[furan-2-yl(1H-imidazol-2-yl)methylidene]amino]-2,4-dinitroaniline (PubChem CID 135562924) has the molecular formula C14H10N6O5 and a molecular weight of 342.27 g/mol. Its IUPAC name is N-[(E)-[furan-2-yl(1H-imidazol-2-yl)methylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[furan-2-yl(1H-imidazol-2-yl)methylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 135562924 |
| Molecular Formula | C14H10N6O5 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-[(E)-[furan-2-yl(1H-imidazol-2-yl)methylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C(\c2ncc[nH]2)c2ccco2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10N6O5/c21-19(22)9-3-4-10(11(8-9)20(23)24)17-18-13(12-2-1-7-25-12)14-15-5-6-16-14/h1-8,17H,(H,15,16)/b18-13- |
| InChIKey | SLJJBDRRUNWAGJ-AQTBWJFISA-N |
| XLogP | 2.68 |
| TPSA | 152.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|