C15H16N2O — CID 135600935
1-[(2,2-dimethylcyclopropyl)diazenyl]naphthalen-2-ol (PubChem CID 135600935) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-[(2,2-dimethylcyclopropyl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(2,2-dimethylcyclopropyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135600935 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-[(2,2-dimethylcyclopropyl)diazenyl]naphthalen-2-ol |
| SMILES | CC1(C)CC1/N=N/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C15H16N2O/c1-15(2)9-13(15)16-17-14-11-6-4-3-5-10(11)7-8-12(14)18/h3-8,13,18H,9H2,1-2H3/b17-16+ |
| InChIKey | GONBNYVGIHRIJO-WUKNDPDISA-N |
| XLogP | 4.43 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|