C21H22N8O6 — CID 135609043
8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione (PubChem CID 135609043) has the molecular formula C21H22N8O6 and a molecular weight of 482.46 g/mol. Its IUPAC name is 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 135609043 |
| Molecular Formula | C21H22N8O6 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-[2-(4-methoxyphenyl)ethyl]-3-methylpurine-2,6-dione |
| SMILES | COc1ccc(CCn2c(/N=N/c3c(O)n(C)c(=O)n(C)c3=O)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C21H22N8O6/c1-26-15-14(16(30)23-20(26)33)29(10-9-11-5-7-12(35-4)8-6-11)19(22-15)25-24-13-17(31)27(2)21(34)28(3)18(13)32/h5-8,31H,9-10H2,1-4H3,(H,23,30,33)/b25-24+ |
| InChIKey | WXGBOJOGXLJPRS-OCOZRVBESA-N |
| XLogP | 0.19 |
| TPSA | 170.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|