C19H22N6O3 — CID 91897396
7-(2-methoxyethyl)-3-methyl-8-[[(E)-4-phenylbut-2-en-2-yl]diazenyl]purine-2,6-dione (PubChem CID 91897396) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-3-methyl-8-[[(E)-4-phenylbut-2-en-2-yl]diazenyl]purine-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-3-methyl-8-[[(E)-4-phenylbut-2-en-2-yl]diazenyl]purine-2,6-dione |
|---|---|
| PubChem CID | 91897396 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 7-(2-methoxyethyl)-3-methyl-8-[[(E)-4-phenylbut-2-en-2-yl]diazenyl]purine-2,6-dione |
| SMILES | COCCn1c(/N=N/C(C)=C/Cc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C19H22N6O3/c1-13(9-10-14-7-5-4-6-8-14)22-23-18-20-16-15(25(18)11-12-28-3)17(26)21-19(27)24(16)2/h4-9H,10-12H2,1-3H3,(H,21,26,27)/b13-9+,23-22+ |
| InChIKey | JKQMKLVAMQQFGT-QQZHPOJYSA-N |
| XLogP | 2.30 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|