C13H17NO4S — CID 135659298
2-[1-(2,4-dihydroxyphenyl)ethylideneamino]-4-methylsulfanylbutanoic acid (PubChem CID 135659298) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[1-(2,4-dihydroxyphenyl)ethylideneamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[1-(2,4-dihydroxyphenyl)ethylideneamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 135659298 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[1-(2,4-dihydroxyphenyl)ethylideneamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(/N=C(\C)c1ccc(O)cc1O)C(=O)O |
| InChI | InChI=1S/C13H17NO4S/c1-8(10-4-3-9(15)7-12(10)16)14-11(13(17)18)5-6-19-2/h3-4,7,11,15-16H,5-6H2,1-2H3,(H,17,18)/b14-8+ |
| InChIKey | BVBDQQORDPHDCT-RIYZIHGNSA-N |
| XLogP | 2.11 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|