C20H21N3O3S — CID 135665167
(2S)-1-(2,3-dihydroindol-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutan-1-one (PubChem CID 135665167) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is (2S)-1-(2,3-dihydroindol-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutan-1-one.
| Compound Name | (2S)-1-(2,3-dihydroindol-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 135665167 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2S)-1-(2,3-dihydroindol-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutan-1-one |
| SMILES | CC(C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H21N3O3S/c1-13(2)18(20(24)23-12-11-14-7-3-5-9-16(14)23)21-19-15-8-4-6-10-17(15)27(25,26)22-19/h3-10,13,18H,11-12H2,1-2H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | NDWOOAVMBGNDTB-SFHVURJKSA-N |
| XLogP | 2.34 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|