C18H11NO2S — CID 135711152
3-(1,3-benzothiazol-2-yl)-2-hydroxynaphthalene-1-carbaldehyde (PubChem CID 135711152) has the molecular formula C18H11NO2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-hydroxynaphthalene-1-carbaldehyde.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2-hydroxynaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 135711152 |
| Molecular Formula | C18H11NO2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2-hydroxynaphthalene-1-carbaldehyde |
| SMILES | O=Cc1c(O)c(-c2nc3ccccc3s2)cc2ccccc12 |
| InChI | InChI=1S/C18H11NO2S/c20-10-14-12-6-2-1-5-11(12)9-13(17(14)21)18-19-15-7-3-4-8-16(15)22-18/h1-10,21H |
| InChIKey | BAYSMYGBRRNWQS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|