C26H22N3NaO5S — CID 135713844
sodium 4-hydroxy-3-[[2-methyl-4-[(1-oxo-1-phenylpropan-2-yl)amino]phenyl]diazenyl]naphthalene-1-sulfonate (PubChem CID 135713844) has the molecular formula C26H22N3NaO5S and a molecular weight of 511.54 g/mol. Its IUPAC name is sodium 4-hydroxy-3-[[2-methyl-4-[(1-oxo-1-phenylpropan-2-yl)amino]phenyl]diazenyl]naphthalene-1-sulfonate.
| Compound Name | sodium 4-hydroxy-3-[[2-methyl-4-[(1-oxo-1-phenylpropan-2-yl)amino]phenyl]diazenyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 135713844 |
| Molecular Formula | C26H22N3NaO5S |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | sodium 4-hydroxy-3-[[2-methyl-4-[(1-oxo-1-phenylpropan-2-yl)amino]phenyl]diazenyl]naphthalene-1-sulfonate |
| SMILES | Cc1cc(NC(C)C(=O)c2ccccc2)ccc1/N=N/c1cc(S(=O)(=O)[O-])c2ccccc2c1O.[Na+] |
| InChI | InChI=1S/C26H23N3O5S.Na/c1-16-14-19(27-17(2)25(30)18-8-4-3-5-9-18)12-13-22(16)28-29-23-15-24(35(32,33)34)20-10-6-7-11-21(20)26(23)31;/h3-15,17,27,31H,1-2H3,(H,32,33,34);/q;+1/p-1/b29-28+; |
| InChIKey | GRKSWZDNEISBDS-IRWWKPKRSA-M |
| XLogP | 2.86 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|