C3H6N4O3 — CID 135753905
(NE)-N-(oxadiazinan-4-ylidene)nitramide (PubChem CID 135753905) has the molecular formula C3H6N4O3 and a molecular weight of 146.11 g/mol. Its IUPAC name is (NE)-N-(oxadiazinan-4-ylidene)nitramide.
| Compound Name | (NE)-N-(oxadiazinan-4-ylidene)nitramide |
|---|---|
| PubChem CID | 135753905 |
| Molecular Formula | C3H6N4O3 |
| Molecular Weight | 146.11 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | (NE)-N-(oxadiazinan-4-ylidene)nitramide |
| SMILES | O=[N+]([O-])/N=C1\CCONN1 |
| InChI | InChI=1S/C3H6N4O3/c8-7(9)5-3-1-2-10-6-4-3/h6H,1-2H2,(H,4,5) |
| InChIKey | OXQUUQYWPUJRHT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.11 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|