C4H7N7O3 — CID 135938772
(NZ)-N-[(4aS,7aS)-6-oxo-2,4,4a,5,7,7a-hexahydro-1H-imidazo[4,5-e][1,2,4]triazin-3-ylidene]nitramide (PubChem CID 135938772) has the molecular formula C4H7N7O3 and a molecular weight of 201.15 g/mol. Its IUPAC name is (NZ)-N-[(4aS,7aS)-6-oxo-2,4,4a,5,7,7a-hexahydro-1H-imidazo[4,5-e][1,2,4]triazin-3-ylidene]nitramide.
| Compound Name | (NZ)-N-[(4aS,7aS)-6-oxo-2,4,4a,5,7,7a-hexahydro-1H-imidazo[4,5-e][1,2,4]triazin-3-ylidene]nitramide |
|---|---|
| PubChem CID | 135938772 |
| Molecular Formula | C4H7N7O3 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (NZ)-N-[(4aS,7aS)-6-oxo-2,4,4a,5,7,7a-hexahydro-1H-imidazo[4,5-e][1,2,4]triazin-3-ylidene]nitramide |
| SMILES | O=C1N[C@H]2NN/C(=N\[N+](=O)[O-])N[C@H]2N1 |
| InChI | InChI=1S/C4H7N7O3/c12-4-6-1-2(7-4)8-9-3(5-1)10-11(13)14/h1-2,8H,(H2,5,9,10)(H2,6,7,12)/t1-,2-/m0/s1 |
| InChIKey | OWYMZGBBWJOAEU-LWMBPPNESA-N |
| XLogP | -2.80 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|