C9H11N3O3 — CID 175496625
8-nitro-1,2,4,5-tetrahydro-3,2-benzoxazepin-7-amine (PubChem CID 175496625) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 8-nitro-1,2,4,5-tetrahydro-3,2-benzoxazepin-7-amine.
| Compound Name | 8-nitro-1,2,4,5-tetrahydro-3,2-benzoxazepin-7-amine |
|---|---|
| PubChem CID | 175496625 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 8-nitro-1,2,4,5-tetrahydro-3,2-benzoxazepin-7-amine |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])CNOCC2 |
| InChI | InChI=1S/C9H11N3O3/c10-8-3-6-1-2-15-11-5-7(6)4-9(8)12(13)14/h3-4,11H,1-2,5,10H2 |
| InChIKey | IORSEQBNTYHUQM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|