C16H14N2O7S — CID 135766451
methyl 5-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxymethyl]furan-2-carboxylate (PubChem CID 135766451) has the molecular formula C16H14N2O7S and a molecular weight of 378.36 g/mol. Its IUPAC name is methyl 5-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 135766451 |
| Molecular Formula | C16H14N2O7S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | methyl 5-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)C/N=C2\NS(=O)(=O)c3ccccc32)o1 |
| InChI | InChI=1S/C16H14N2O7S/c1-23-16(20)12-7-6-10(25-12)9-24-14(19)8-17-15-11-4-2-3-5-13(11)26(21,22)18-15/h2-7H,8-9H2,1H3,(H,17,18) |
| InChIKey | RIKPGAZASSXVRY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|