C3H8O3 — CID 135775433
(1R)-1-deuteriopropane-1,2,3-triol (PubChem CID 135775433) has the molecular formula C3H8O3 and a molecular weight of 93.10 g/mol. Its IUPAC name is (1R)-1-deuteriopropane-1,2,3-triol.
| Compound Name | (1R)-1-deuteriopropane-1,2,3-triol |
|---|---|
| PubChem CID | 135775433 |
| Molecular Formula | C3H8O3 |
| Molecular Weight | 93.10 g/mol |
| Exact Mass | 93.05 |
| IUPAC Name | (1R)-1-deuteriopropane-1,2,3-triol |
| SMILES | [2H][C@@H](O)C(O)CO |
| InChI | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1D/t1-,3?/m1/s1 |
| InChIKey | PEDCQBHIVMGVHV-LNKRRZBXSA-N |
| XLogP | -1.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 93.10 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |