About (1R)-1-deuteriopropane-1,2,3-triol
(1R)-1-deuteriopropane-1,2,3-triol (PubChem CID 135775433) has the molecular formula C3H8O3
and a molecular weight of 93.10 g/mol. Its IUPAC name is (1R)-1-deuteriopropane-1,2,3-triol.
Molecular Properties
| Compound Name | (1R)-1-deuteriopropane-1,2,3-triol |
| PubChem CID | 135775433 |
| Molecular Formula | C3H8O3 |
| Molecular Weight | 93.10 g/mol |
| Exact Mass | 93.05 |
| IUPAC Name | (1R)-1-deuteriopropane-1,2,3-triol |
| SMILES | [2H][C@@H](O)C(O)CO |
| InChI | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1D/t1-,3?/m1/s1 |
| InChIKey | PEDCQBHIVMGVHV-LNKRRZBXSA-N |
| XLogP | -1.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.10 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-deuteriopropane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-deuteriopropane-1,2,3-triol?
The IUPAC name of (1R)-1-deuteriopropane-1,2,3-triol (CID 135775433) is (1R)-1-deuteriopropane-1,2,3-triol.
What is the SMILES notation for (1R)-1-deuteriopropane-1,2,3-triol?
The canonical SMILES for (1R)-1-deuteriopropane-1,2,3-triol is [2H][C@@H](O)C(O)CO.
What is the InChIKey of (1R)-1-deuteriopropane-1,2,3-triol?
The InChIKey is PEDCQBHIVMGVHV-LNKRRZBXSA-N. The full InChI is InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1D/t1-,3?/m1/s1.
What are the key properties of (1R)-1-deuteriopropane-1,2,3-triol?
(1R)-1-deuteriopropane-1,2,3-triol has a molecular weight of 93.10 g/mol, XLogP of -1.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-deuteriopropane-1,2,3-triol is sourced from PubChem (CID 135775433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).