C11H13N5O3 — CID 135789850
6-amino-4-(3,4-dimethoxyanilino)-1H-1,3,5-triazin-2-one (PubChem CID 135789850) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 6-amino-4-(3,4-dimethoxyanilino)-1H-1,3,5-triazin-2-one.
| Compound Name | 6-amino-4-(3,4-dimethoxyanilino)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135789850 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 6-amino-4-(3,4-dimethoxyanilino)-1H-1,3,5-triazin-2-one |
| SMILES | COc1ccc(Nc2nc(N)[nH]c(=O)n2)cc1OC |
| InChI | InChI=1S/C11H13N5O3/c1-18-7-4-3-6(5-8(7)19-2)13-10-14-9(12)15-11(17)16-10/h3-5H,1-2H3,(H4,12,13,14,15,16,17) |
| InChIKey | JXRNHETVRNVQLH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |