C14H4Cl2N4O — CID 135794560
(2E)-2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4,5-diisocyanopyrrole-3-carbonitrile (PubChem CID 135794560) has the molecular formula C14H4Cl2N4O and a molecular weight of 315.12 g/mol. Its IUPAC name is (2E)-2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4,5-diisocyanopyrrole-3-carbonitrile.
| Compound Name | (2E)-2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4,5-diisocyanopyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 135794560 |
| Molecular Formula | C14H4Cl2N4O |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | (2E)-2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4,5-diisocyanopyrrole-3-carbonitrile |
| SMILES | [C-]#[N+]C1=N/C(=C/c2cc(Cl)c(O)c(Cl)c2)C(C#N)=C1[N+]#[C-] |
| InChI | InChI=1S/C14H4Cl2N4O/c1-18-12-8(6-17)11(20-14(12)19-2)5-7-3-9(15)13(21)10(16)4-7/h3-5,21H/b11-5+ |
| InChIKey | BSIZHKGGEPTHIE-VZUCSPMQSA-N |
| XLogP | 4.07 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|