C20H25N5O5-2 — CID 135797835
(Z)-but-2-enedioate;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-1-pentylguanidine (PubChem CID 135797835) has the molecular formula C20H25N5O5-2 and a molecular weight of 415.45 g/mol. Its IUPAC name is (Z)-but-2-enedioate;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-1-pentylguanidine.
| Compound Name | (Z)-but-2-enedioate;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-1-pentylguanidine |
|---|---|
| PubChem CID | 135797835 |
| Molecular Formula | C20H25N5O5-2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (Z)-but-2-enedioate;1-[(Z)-(5-methoxy-1H-indol-3-yl)methylideneamino]-1-pentylguanidine |
| SMILES | O=C([O-])/C=C\C(=O)[O-].[H]/N=C(\N)N(CCCCC)/N=C\c1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C16H23N5O.C4H4O4/c1-3-4-5-8-21(16(17)18)20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;5-3(6)1-2-4(7)8/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18);1-2H,(H,5,6)(H,7,8)/p-2/b20-11-;2-1- |
| InChIKey | GXDOUYAKBHADFQ-QPRIGUFLSA-L |
| XLogP | -0.06 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|