C16H25N5O — CID 142314543
(5-methoxy-1H-indol-3-yl)methanimine;2-pentylguanidine (PubChem CID 142314543) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is (5-methoxy-1H-indol-3-yl)methanimine;2-pentylguanidine.
| Compound Name | (5-methoxy-1H-indol-3-yl)methanimine;2-pentylguanidine |
|---|---|
| PubChem CID | 142314543 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | (5-methoxy-1H-indol-3-yl)methanimine;2-pentylguanidine |
| SMILES | CCCCCN=C(N)N.[H]/N=C/c1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C10H10N2O.C6H15N3/c1-13-8-2-3-10-9(4-8)7(5-11)6-12-10;1-2-3-4-5-9-6(7)8/h2-6,11-12H,1H3;2-5H2,1H3,(H4,7,8,9)/b11-5+; |
| InChIKey | SDJWLISPQFBYHH-HMXKFKBXSA-N |
| XLogP | 2.62 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|