C20H27N5O5 — CID 170919772
but-2-enedioic acid;1-[(5-methoxy-1H-indol-3-yl)methylimino]-2-pentylguanidine (PubChem CID 170919772) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is but-2-enedioic acid;1-[(5-methoxy-1H-indol-3-yl)methylimino]-2-pentylguanidine.
| Compound Name | but-2-enedioic acid;1-[(5-methoxy-1H-indol-3-yl)methylimino]-2-pentylguanidine |
|---|---|
| PubChem CID | 170919772 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | but-2-enedioic acid;1-[(5-methoxy-1H-indol-3-yl)methylimino]-2-pentylguanidine |
| SMILES | CCCCC/N=C(N)/N=N/Cc1c[nH]c2ccc(OC)cc12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H23N5O.C4H4O4/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;5-3(6)1-2-4(7)8/h6-7,9-10,19H,3-5,8,11H2,1-2H3,(H2,17,18);1-2H,(H,5,6)(H,7,8)/b21-20+; |
| InChIKey | XDTYDANDEYJSTK-ANVLNOONSA-N |
| XLogP | 3.35 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|