C18H16ClN3O4PS+ — CID 135839794
[2-[4-(benzenesulfonamido)-2-chlorophenyl]hydrazinyl]-oxo-phenoxyphosphanium (PubChem CID 135839794) has the molecular formula C18H16ClN3O4PS+ and a molecular weight of 436.84 g/mol. Its IUPAC name is [2-[4-(benzenesulfonamido)-2-chlorophenyl]hydrazinyl]-oxo-phenoxyphosphanium.
| Compound Name | [2-[4-(benzenesulfonamido)-2-chlorophenyl]hydrazinyl]-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 135839794 |
| Molecular Formula | C18H16ClN3O4PS+ |
| Molecular Weight | 436.84 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [2-[4-(benzenesulfonamido)-2-chlorophenyl]hydrazinyl]-oxo-phenoxyphosphanium |
| SMILES | O=[P+](NNc1ccc(NS(=O)(=O)c2ccccc2)cc1Cl)Oc1ccccc1 |
| InChI | InChI=1S/C18H16ClN3O4PS/c19-17-13-14(21-28(24,25)16-9-5-2-6-10-16)11-12-18(17)20-22-27(23)26-15-7-3-1-4-8-15/h1-13,20-21H,(H,22,23)/q+1 |
| InChIKey | QQGNKUCZUZPCFK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|