C26H26N4O4S4 — CID 135869466
2-(2-hydroxyphenyl)-N-[2-[2-[2-[[2-(2-hydroxyphenyl)-1,3-thiazole-4-carbothioyl]amino]ethoxy]ethoxy]ethyl]-1,3-thiazole-4-carbothioamide (PubChem CID 135869466) has the molecular formula C26H26N4O4S4 and a molecular weight of 586.79 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-N-[2-[2-[2-[[2-(2-hydroxyphenyl)-1,3-thiazole-4-carbothioyl]amino]ethoxy]ethoxy]ethyl]-1,3-thiazole-4-carbothioamide.
| Compound Name | 2-(2-hydroxyphenyl)-N-[2-[2-[2-[[2-(2-hydroxyphenyl)-1,3-thiazole-4-carbothioyl]amino]ethoxy]ethoxy]ethyl]-1,3-thiazole-4-carbothioamide |
|---|---|
| PubChem CID | 135869466 |
| Molecular Formula | C26H26N4O4S4 |
| Molecular Weight | 586.79 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | 2-(2-hydroxyphenyl)-N-[2-[2-[2-[[2-(2-hydroxyphenyl)-1,3-thiazole-4-carbothioyl]amino]ethoxy]ethoxy]ethyl]-1,3-thiazole-4-carbothioamide |
| SMILES | Oc1ccccc1-c1nc(C(=S)NCCOCCOCCNC(=S)c2csc(-c3ccccc3O)n2)cs1 |
| InChI | InChI=1S/C26H26N4O4S4/c31-21-7-3-1-5-17(21)25-29-19(15-37-25)23(35)27-9-11-33-13-14-34-12-10-28-24(36)20-16-38-26(30-20)18-6-2-4-8-22(18)32/h1-8,15-16,31-32H,9-14H2,(H,27,35)(H,28,36) |
| InChIKey | GAAVIEINXXYEPX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|