C34H30N4O2 — CID 135879748
(12Z)-12-(hydroxymethylidene)-21,21-dimethyl-9-(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5(26),6,8,10,13(25),14,16,18(24),19-decaen-4-one (PubChem CID 135879748) has the molecular formula C34H30N4O2 and a molecular weight of 526.64 g/mol. Its IUPAC name is (12Z)-12-(hydroxymethylidene)-21,21-dimethyl-9-(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5(26),6,8,10,13(25),14,16,18(24),19-decaen-4-one.
| Compound Name | (12Z)-12-(hydroxymethylidene)-21,21-dimethyl-9-(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5(26),6,8,10,13(25),14,16,18(24),19-decaen-4-one |
|---|---|
| PubChem CID | 135879748 |
| Molecular Formula | C34H30N4O2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (12Z)-12-(hydroxymethylidene)-21,21-dimethyl-9-(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5(26),6,8,10,13(25),14,16,18(24),19-decaen-4-one |
| SMILES | Cc1cc(C)c(/C2=C3\C=C4C(=O)C/C(=C5\CC(C)(C)/C(=C/C6=N/C(=C\C7=NC2=C/C7=C/O)C=C6)N5)C4=N3)c(C)c1 |
| InChI | InChI=1S/C34H30N4O2/c1-17-8-18(2)31(19(3)9-17)32-26-10-20(16-39)25(36-26)11-21-6-7-22(35-21)12-30-34(4,5)15-28(37-30)23-14-29(40)24-13-27(32)38-33(23)24/h6-13,16,37,39H,14-15H2,1-5H3/b20-16-,21-11-,28-23-,30-12-,32-27+ |
| InChIKey | ORUKPUGVGSDRND-NMGQMBFCSA-N |
| XLogP | 6.52 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|