C35H34N4O2 — CID 135468120
1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone (PubChem CID 135468120) has the molecular formula C35H34N4O2 and a molecular weight of 542.68 g/mol. Its IUPAC name is 1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone.
| Compound Name | 1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone |
|---|---|
| PubChem CID | 135468120 |
| Molecular Formula | C35H34N4O2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone |
| SMILES | CC(=O)C1=CC2=N/C1=C\C1=N/C(=C(/c3c(C)cc(C)cc3C)C3=C/C(=C(\C)O)C(=N3)/C=C3/CC(C)(C)/C(=C/2)N3)C=C1 |
| InChI | InChI=1S/C35H34N4O2/c1-18-10-19(2)33(20(3)11-18)34-28-9-8-23(36-28)13-29-26(21(4)40)12-24(37-29)15-32-35(6,7)17-25(38-32)14-30-27(22(5)41)16-31(34)39-30/h8-16,38,41H,17H2,1-7H3/b25-14-,27-22-,29-13-,32-15-,34-28+ |
| InChIKey | FWXWACZIDBJTCB-KTOUNFLTSA-N |
| XLogP | 7.16 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|