C33H28N4O2Zn — CID 16745197
zinc (Z)-[12-formyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate (PubChem CID 16745197) has the molecular formula C33H28N4O2Zn and a molecular weight of 578.00 g/mol. Its IUPAC name is zinc (Z)-[12-formyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate.
| Compound Name | zinc (Z)-[12-formyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate |
|---|---|
| PubChem CID | 16745197 |
| Molecular Formula | C33H28N4O2Zn |
| Molecular Weight | 578.00 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | zinc (Z)-[12-formyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C=C3\N=C(C=C3C=O)/C=C3\N=C(/C=c4\[n-]c2c\c4=C\[O-])CC3(C)C)c(C)c1.[Zn+2] |
| InChI | InChI=1S/C33H30N4O2.Zn/c1-18-8-19(2)31(20(3)9-18)32-26-7-6-23(34-26)12-27-21(16-38)10-24(35-27)14-30-33(4,5)15-25(36-30)13-28-22(17-39)11-29(32)37-28;/h6-14,16-17H,15H2,1-5H3,(H2,34,35,36,37,38,39);/q;+2/p-2 |
| InChIKey | MODXCIFQOPHVRE-UHFFFAOYSA-L |
| XLogP | 3.45 |
| TPSA | 91.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.00 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|