C33H30N4OZn — CID 11497794
zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate (PubChem CID 11497794) has the molecular formula C33H30N4OZn and a molecular weight of 564.02 g/mol. Its IUPAC name is zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate.
| Compound Name | zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate |
|---|---|
| PubChem CID | 11497794 |
| Molecular Formula | C33H30N4OZn |
| Molecular Weight | 564.02 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate |
| SMILES | C/C([O-])=c1\cc2[n-]\c1=C/C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2c2c(C)cc(C)cc2C)C=C4)C=C3)C(C)(C)C1.[Zn+2] |
| InChI | InChI=1S/C33H31N4O.Zn/c1-18-11-19(2)31(20(3)12-18)32-27-10-9-23(35-27)13-22-7-8-24(34-22)15-30-33(5,6)17-25(36-30)14-28-26(21(4)38)16-29(32)37-28;/h7-16H,17H2,1-6H3,(H-,34,35,36,37,38);/q-1;+2/p-1 |
| InChIKey | IWUCJQWSUQGSEN-UHFFFAOYSA-M |
| XLogP | 4.27 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.02 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|