C39H34N4OZn — CID 16742703
zinc (Z)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-22-id-2-ylidene]methanolate (PubChem CID 16742703) has the molecular formula C39H34N4OZn and a molecular weight of 640.12 g/mol. Its IUPAC name is zinc (Z)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-22-id-2-ylidene]methanolate.
| Compound Name | zinc (Z)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-22-id-2-ylidene]methanolate |
|---|---|
| PubChem CID | 16742703 |
| Molecular Formula | C39H34N4OZn |
| Molecular Weight | 640.12 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | zinc (Z)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-22-id-2-ylidene]methanolate |
| SMILES | Cc1ccc(/C2=c3\cc/c([n-]3)=C(\c3c(C)cc(C)cc3C)C3=C/C(=C/[O-])C(=N3)/C=C3/CC(C)(C)C(=N3)/C=C3/C=CC2=N3)cc1.[Zn+2] |
| InChI | InChI=1S/C39H35N4O.Zn/c1-22-7-9-26(10-8-22)37-30-12-11-28(40-30)19-35-39(5,6)20-29(41-35)18-33-27(21-44)17-34(43-33)38(32-14-13-31(37)42-32)36-24(3)15-23(2)16-25(36)4;/h7-19,21H,20H2,1-6H3,(H-,40,41,42,43,44);/q-1;+2/p-1 |
| InChIKey | LGCZTOULRLPGIO-UHFFFAOYSA-M |
| XLogP | 5.52 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.12 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|