C32H28N4OZn — CID 16745196
zinc (Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate (PubChem CID 16745196) has the molecular formula C32H28N4OZn and a molecular weight of 549.99 g/mol. Its IUPAC name is zinc (Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate.
| Compound Name | zinc (Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate |
|---|---|
| PubChem CID | 16745196 |
| Molecular Formula | C32H28N4OZn |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | zinc (Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]methanolate |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C=C3/C=CC(=N3)/C=C3\N=C(/C=c4\[n-]c2c\c4=C\[O-])CC3(C)C)c(C)c1.[Zn+2] |
| InChI | InChI=1S/C32H29N4O.Zn/c1-18-10-19(2)30(20(3)11-18)31-26-9-8-23(34-26)13-22-6-7-24(33-22)15-29-32(4,5)16-25(35-29)14-27-21(17-37)12-28(31)36-27;/h6-15,17H,16H2,1-5H3,(H-,33,34,35,36,37);/q-1;+2/p-1 |
| InChIKey | XCXKBFIOYMHQMP-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|