C33H30N4O2 — CID 136826537
12-(hydroxymethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-carbaldehyde (PubChem CID 136826537) has the molecular formula C33H30N4O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 12-(hydroxymethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-carbaldehyde.
| Compound Name | 12-(hydroxymethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-carbaldehyde |
|---|---|
| PubChem CID | 136826537 |
| Molecular Formula | C33H30N4O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 12-(hydroxymethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-carbaldehyde |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C=C3\N=C(C=C3C=O)/C=C3\N/C(=C\C4=NC2=CC4=CO)CC3(C)C)c(C)c1 |
| InChI | InChI=1S/C33H30N4O2/c1-18-8-19(2)31(20(3)9-18)32-26-7-6-23(34-26)12-27-21(16-38)10-24(35-27)14-30-33(4,5)15-25(36-30)13-28-22(17-39)11-29(32)37-28/h6-14,16-17,36,39H,15H2,1-5H3/b22-17?,25-13-,27-12-,30-14-,32-26+ |
| InChIKey | IRPNBIYZNFWVGJ-VZNOXTQSSA-N |
| XLogP | 6.38 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|