C40H38N4O — CID 135710936
(1Z)-1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol (PubChem CID 135710936) has the molecular formula C40H38N4O and a molecular weight of 590.77 g/mol. Its IUPAC name is (1Z)-1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol.
| Compound Name | (1Z)-1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
|---|---|
| PubChem CID | 135710936 |
| Molecular Formula | C40H38N4O |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | (1Z)-1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
| SMILES | C/C(O)=C1\C=C2N=C1/C=C1/CC(C)(C)/C(=C/C3=N/C(=C(/c4ccc(C)cc4)C4=N/C(=C\2c2c(C)cc(C)cc2C)C=C4)C=C3)N1 |
| InChI | InChI=1S/C40H38N4O/c1-22-8-10-27(11-9-22)38-31-13-12-28(41-31)19-36-40(6,7)21-29(42-36)18-34-30(26(5)45)20-35(44-34)39(33-15-14-32(38)43-33)37-24(3)16-23(2)17-25(37)4/h8-20,42,45H,21H2,1-7H3/b29-18-,30-26-,36-19-,38-31-,39-33+ |
| InChIKey | FVCDBLGPFMQHMF-JHUCDSTMSA-N |
| XLogP | 9.04 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|